Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite BUTYRIC_ACID == * common-name: ** butanoate * smiles: ** cccc(=o)[o-] * inchi-key: ** feriucnnqqjtoy-uhfffaoysa-m * molecular-weight: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13575 ==
+
== Metabolite BUTYRIC_ACID ==
 
* common-name:
 
* common-name:
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
+
** butanoate
 
* smiles:
 
* smiles:
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
+
** cccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** pqmcqnovnfnpfj-hyimlasbsa-k
+
** feriucnnqqjtoy-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 264.169
+
** 87.098
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12611]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIAZOLSYN2-RXN]]
+
* [[RXN-12086]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
+
{{#set: common-name=butanoate}}
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
+
{{#set: inchi-key=inchikey=feriucnnqqjtoy-uhfffaoysa-m}}
{{#set: molecular-weight=264.169}}
+
{{#set: molecular-weight=87.098}}

Revision as of 13:09, 14 January 2021

Metabolite BUTYRIC_ACID

  • common-name:
    • butanoate
  • smiles:
    • cccc(=o)[o-]
  • inchi-key:
    • feriucnnqqjtoy-uhfffaoysa-m
  • molecular-weight:
    • 87.098

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality