Difference between revisions of "5-HYDROXY-CONIFERALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-methylcrotonoyl-CoA-carboxylase-lysine == * common-name: ** a [3-methylcrotonoyl-coa-carboxylase]-l-lysine == Reaction(s) known to cons...")
(Created page with "Category:metabolite == Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE == * common-name: ** s-adenosyl-4-methylthio-2-oxobutanoate * smiles: ** c[s+](ccc(c([o-])=o)=o)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-methylcrotonoyl-CoA-carboxylase-lysine ==
+
== Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE ==
 
* common-name:
 
* common-name:
** a [3-methylcrotonoyl-coa-carboxylase]-l-lysine
+
** s-adenosyl-4-methylthio-2-oxobutanoate
 +
* smiles:
 +
** c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
 +
* inchi-key:
 +
** uokvqqmbgvmxpu-cjpdyehrsa-n
 +
* molecular-weight:
 +
** 397.405
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.3.4.11-RXN]]
+
* [[DAPASYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DAPASYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [3-methylcrotonoyl-coa-carboxylase]-l-lysine}}
+
{{#set: common-name=s-adenosyl-4-methylthio-2-oxobutanoate}}
 +
{{#set: inchi-key=inchikey=uokvqqmbgvmxpu-cjpdyehrsa-n}}
 +
{{#set: molecular-weight=397.405}}

Revision as of 08:26, 15 March 2021

Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE

  • common-name:
    • s-adenosyl-4-methylthio-2-oxobutanoate
  • smiles:
    • c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
  • inchi-key:
    • uokvqqmbgvmxpu-cjpdyehrsa-n
  • molecular-weight:
    • 397.405

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality