Difference between revisions of "5-HYDROXY-CONIFERALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01255 == * transcription-direction: ** negative * right-end-position: ** 111204 * left-end-position: ** 92324 * centisome-position: ** 60.07939...")
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CONIFERALDEHYDE == * common-name: ** 5-hydroxy-coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc(o)=c(o)1) * inchi-key: ** iehpl...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01255 ==
+
== Metabolite 5-HYDROXY-CONIFERALDEHYDE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5-hydroxy-coniferaldehyde
−
* right-end-position:
+
* smiles:
−
** 111204
+
** coc1(=cc(c=cc=o)=cc(o)=c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 92324
+
** iehplrvwohzkcs-nscuhmnnsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 60.07939   
+
** 194.187
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-1143]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.151-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-hydroxy-coniferaldehyde}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=iehplrvwohzkcs-nscuhmnnsa-n}}
−
* [[2.4.1.46-RXN]]
+
{{#set: molecular-weight=194.187}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-16027]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7434]]
 
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-401]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=111204}}
 
−
{{#set: left-end-position=92324}}
 
−
{{#set: centisome-position=60.07939    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 5-HYDROXY-CONIFERALDEHYDE

  • common-name:
    • 5-hydroxy-coniferaldehyde
  • smiles:
    • coc1(=cc(c=cc=o)=cc(o)=c(o)1)
  • inchi-key:
    • iehplrvwohzkcs-nscuhmnnsa-n
  • molecular-weight:
    • 194.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-HYDROXY-CONIFERALDEHYDE&oldid=137466"