Difference between revisions of "5-HYDROXY-CONIFERALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-I-CIT == * common-name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-] * inchi-key: ** oejzzcgrgvfwhk...") |
(Created page with "Category:metabolite == Metabolite CPD-10280 == * common-name: ** lignoceroyl-coa * smiles: ** cccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10280 == |
* common-name: | * common-name: | ||
− | ** | + | ** lignoceroyl-coa |
* smiles: | * smiles: | ||
− | ** c( | + | ** cccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** moymqyzwiukggy-jbkavqfisa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1114.129 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]] |
− | * [[RXN- | + | * [[RXN-13296]] |
+ | * [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]] | ||
+ | * [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-10280/WATER//TETRACOSANOATE/CO-A/PROTON.57.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13308]] |
− | * [[RXN- | + | * [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]] |
+ | * [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10280/NAD//CPD-14282/NADH/PROTON.37.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=lignoceroyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=moymqyzwiukggy-jbkavqfisa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1114.129}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-10280
- common-name:
- lignoceroyl-coa
- smiles:
- cccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- moymqyzwiukggy-jbkavqfisa-j
- molecular-weight:
- 1114.129
Reaction(s) known to consume the compound
- ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.
- RXN-13296
- RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.
- [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-10280/WATER//TETRACOSANOATE/CO-A/PROTON.57.]]
Reaction(s) known to produce the compound
- RXN-13308
- RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.
- TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10280/NAD//CPD-14282/NADH/PROTON.37.