Difference between revisions of "5-HYDROXY-FERULIC-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...")
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DGMP ==
+
== Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL ==
 
* common-name:
 
* common-name:
** dgmp
+
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ltfmzdnnppeqng-kvqbguixsa-l
+
** zagwhopypmukok-fricuitqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 548.848
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDGM]]
+
* [[RXN3O-54]]
* [[DMPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DGTD]]
 
* [[DMPH]]
 
* [[RXN-14208]]
 
* [[RXN-14218]]
 
* [[RXN0-385]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dgmp}}
+
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}
+
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=548.848}}

Revision as of 11:14, 15 January 2021

Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL

  • common-name:
    • 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
  • inchi-key:
    • zagwhopypmukok-fricuitqsa-n
  • molecular-weight:
    • 548.848

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality