Difference between revisions of "5-HYDROXY-FERULIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02517 == * transcription-direction: ** negative * right-end-position: ** 46639 * left-end-position: ** 3400 * centisome-position: ** 2.526322 =...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * smiles: ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) * inchi-key: ** yfxwtvldsk...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5-HYDROXY-FERULIC-ACID == |
− | * | + | * common-name: |
− | ** | + | ** 5-hydroxyferulate |
− | * | + | * smiles: |
− | ** | + | ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) |
− | * | + | * inchi-key: |
− | ** | + | ** yfxwtvldsksylw-nscuhmnnsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 209.178 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-3422]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-1121]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=5-hydroxyferulate}} | |
− | + | {{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}} | |
− | + | {{#set: molecular-weight=209.178}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 5-HYDROXY-FERULIC-ACID
- common-name:
- 5-hydroxyferulate
- smiles:
- coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
- inchi-key:
- yfxwtvldsksylw-nscuhmnnsa-m
- molecular-weight:
- 209.178