Difference between revisions of "5-HYDROXY-TRYPTOPHAN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TusE-S-sulfanylcysteine == * common-name: ** a [tuse sulfur carrier protein]-s-sulfanylcysteine == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-HYDROXY-TRYPTOPHAN == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-hydroxy-l-tryptophan |
+ | * smiles: | ||
+ | ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) | ||
+ | * inchi-key: | ||
+ | ** ldcyzajdbxycgn-vifpvbqesa-n | ||
+ | * molecular-weight: | ||
+ | ** 220.227 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN3DJ-170]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-hydroxy-l-tryptophan}} |
+ | {{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}} | ||
+ | {{#set: molecular-weight=220.227}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5-HYDROXY-TRYPTOPHAN
- common-name:
- 5-hydroxy-l-tryptophan
- smiles:
- c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
- inchi-key:
- ldcyzajdbxycgn-vifpvbqesa-n
- molecular-weight:
- 220.227