Difference between revisions of "5-HYDROXYINDOLE ACETATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2152 == * common-name: ** 1-18:0-2-lysophosphatidylethanolamine * smiles: ** cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * smiles: ** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-])) * inchi-key: ** du...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXYINDOLE_ACETATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxyindole acetate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** duugkqcegzlzno-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 190.178 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10780]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=190.178}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- common-name:
- 5-hydroxyindole acetate
- smiles:
- c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-]))
- inchi-key:
- duugkqcegzlzno-uhfffaoysa-m
- molecular-weight:
- 190.178
