Difference between revisions of "5-HYDROXYINDOLE ACETATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05600 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ACCOAth ** Category: [...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * smiles: ** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-])) * inchi-key: ** du...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5-HYDROXYINDOLE_ACETATE == |
| − | + | * common-name: | |
| − | * | + | ** 5-hydroxyindole acetate |
| − | == | + | * smiles: |
| − | + | ** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-])) | |
| − | * | + | * inchi-key: |
| − | ** | + | ** duugkqcegzlzno-uhfffaoysa-m |
| − | + | * molecular-weight: | |
| − | * | + | ** 190.178 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10780]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=5-hydroxyindole acetate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}} |
| + | {{#set: molecular-weight=190.178}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- common-name:
- 5-hydroxyindole acetate
- smiles:
- c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-]))
- inchi-key:
- duugkqcegzlzno-uhfffaoysa-m
- molecular-weight:
- 190.178
