Difference between revisions of "5-HYDROXYISOURATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14950 RXN-14950] == * direction: ** left-to-right * common-name: ** lipoyl synthase * ec-number...")
(Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * smiles: ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) * inchi-key: ** ltqypavlayvkt...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14950 RXN-14950] ==
+
== Metabolite 5-HYDROXYISOURATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lipoyl synthase
+
** (s)-5-hydroxyisourate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.8.1.8 ec-2.8.1.8]
+
** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Octanoylated-Gcv-H]][c] '''+''' 2 [[Reduced-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 2 [[Sulfurated-Sulfur-Acceptors]][c] '''=>''' 2 [[CH33ADO]][c] '''+''' 2 [[MET]][c] '''+''' 2 [[Oxidized-2Fe-2S-Ferredoxins]][c] '''+''' 1 [[PROTEIN-LIPOYLLYSINE]][c] '''+''' 2 [[Unsulfurated-Sulfur-Acceptors]][c]
+
** ltqypavlayvktk-yfkpbyrvsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04393]]
+
** 184.111
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3.5.2.17-RXN]]
−
* Gene: [[SJ11692]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[URATE-OXIDASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ03663]]
+
{{#set: common-name=(s)-5-hydroxyisourate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=184.111}}
−
== Pathway(s) ==
 
−
* [[PWY-7382]], lipoate biosynthesis and incorporation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7382 PWY-7382]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=lipoyl synthase}}
 
−
{{#set: ec-number=ec-2.8.1.8}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 5-HYDROXYISOURATE

  • common-name:
    • (s)-5-hydroxyisourate
  • smiles:
    • c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
  • inchi-key:
    • ltqypavlayvktk-yfkpbyrvsa-n
  • molecular-weight:
    • 184.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-HYDROXYISOURATE&oldid=138638"