|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IMIDPHOSDEHYD-RXN IMIDPHOSDEHYD-RXN] == | + | == Metabolite 5-HYDROXYISOURATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** imidazoleglycerol-phosphate dehydratase | + | ** (s)-5-hydroxyisourate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.2.1.19 ec-4.2.1.19] | + | ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[D-ERYTHRO-IMIDAZOLE-GLYCEROL-P]][c] '''=>''' 1 [[IMIDAZOLE-ACETOL-P]][c] '''+''' 1 [[WATER]][c] | + | ** ltqypavlayvktk-yfkpbyrvsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ17441]]
| + | ** 184.111 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[3.5.2.17-RXN]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[URATE-OXIDASE-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: common-name=(s)-5-hydroxyisourate}} |
| − | == Pathway(s) == | + | {{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}} |
| − | * [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY]
| + | {{#set: molecular-weight=184.111}} |
| − | ** '''10''' reactions found over '''10''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11041 11041]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03457 R03457]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q58109 Q58109]
| |
| − | ** [http://www.uniprot.org/uniprot/P06633 P06633]
| |
| − | ** [http://www.uniprot.org/uniprot/P10368 P10368]
| |
| − | ** [http://www.uniprot.org/uniprot/P06987 P06987]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PM76 Q9PM76]
| |
| − | ** [http://www.uniprot.org/uniprot/P44327 P44327]
| |
| − | ** [http://www.uniprot.org/uniprot/Q02134 Q02134]
| |
| − | ** [http://www.uniprot.org/uniprot/P64371 P64371]
| |
| − | ** [http://www.uniprot.org/uniprot/Q12578 Q12578]
| |
| − | ** [http://www.uniprot.org/uniprot/P18787 P18787]
| |
| − | ** [http://www.uniprot.org/uniprot/P16247 P16247]
| |
| − | ** [http://www.uniprot.org/uniprot/P28624 P28624]
| |
| − | ** [http://www.uniprot.org/uniprot/P34041 P34041]
| |
| − | ** [http://www.uniprot.org/uniprot/Q02986 Q02986]
| |
| − | ** [http://www.uniprot.org/uniprot/P40374 P40374]
| |
| − | ** [http://www.uniprot.org/uniprot/P48054 P48054]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43072 Q43072]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X7B9 Q9X7B9]
| |
| − | ** [http://www.uniprot.org/uniprot/O48932 O48932]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=imidazoleglycerol-phosphate dehydratase}} | |
| − | {{#set: ec-number=ec-4.2.1.19}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
