Difference between revisions of "5-L-GLUTAMYL-L-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-L-AMINO-ACID == * common-name: ** an α-(γ-l-glutamyl)-l-amino acid == Reaction(s) known to consume the compound...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14392 ==
+
== Metabolite 5-L-GLUTAMYL-L-AMINO-ACID ==
 
* common-name:
 
* common-name:
** stearidonoyl-coa
+
** an α-(γ-l-glutamyl)-l-amino acid
* smiles:
 
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** ddhcsalwdprvcn-uswkvxsksa-j
 
* molecular-weight:
 
** 1021.905
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13426]]
+
* [[RXN-6601]]
* [[RXN-16041]]
+
* [[RXN66-336]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=stearidonoyl-coa}}
+
{{#set: common-name=an α-(γ-l-glutamyl)-l-amino acid}}
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
 
{{#set: molecular-weight=1021.905}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 5-L-GLUTAMYL-L-AMINO-ACID

  • common-name:
    • an α-(γ-l-glutamyl)-l-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality