Difference between revisions of "5-L-GLUTAMYL-L-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite Di-trans-poly-cis-polyprenyl-PP == * common-name: ** a di-trans, poly-cis-polyisoprenyl diphosphate == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14392 ==
+
== Metabolite Di-trans-poly-cis-polyprenyl-PP ==
 
* common-name:
 
* common-name:
** stearidonoyl-coa
+
** a di-trans, poly-cis-polyisoprenyl diphosphate
* smiles:
 
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** ddhcsalwdprvcn-uswkvxsksa-j
 
* molecular-weight:
 
** 1021.905
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11963]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13426]]
+
* [[RXN-11963]]
* [[RXN-16041]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=stearidonoyl-coa}}
+
{{#set: common-name=a di-trans, poly-cis-polyisoprenyl diphosphate}}
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
 
{{#set: molecular-weight=1021.905}}
 

Revision as of 14:55, 5 January 2021

Metabolite Di-trans-poly-cis-polyprenyl-PP

  • common-name:
    • a di-trans, poly-cis-polyisoprenyl diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality