Difference between revisions of "5-L-GLUTAMYL-PEPTIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7107 == * common-name: ** deoxycohumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c * inchi-key: ** kkfizykk...") |
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-PEPTIDE == * common-name: ** a 5-l-glutamyl-[peptide] == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRAN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-L-GLUTAMYL-PEPTIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5-l-glutamyl-[peptide] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[GAMMA-GLUTAMYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5-l-glutamyl-[peptide]}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 5-L-GLUTAMYL-PEPTIDE
- common-name:
- a 5-l-glutamyl-[peptide]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5-l-glutamyl-[peptide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.