Difference between revisions of "5-L-GLUTAMYL-PEPTIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o...")
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-PEPTIDE == * common-name: ** a 5-l-glutamyl-[peptide] == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRAN...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-ATP ==
+
== Metabolite 5-L-GLUTAMYL-PEPTIDE ==
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-atp
+
** a 5-l-glutamyl-[peptide]
* smiles:
 
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 
* inchi-key:
 
** rknhjbvbfhdxgr-keohhstqsa-i
 
* molecular-weight:
 
** 714.24
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
* [[HISTPRATPHYD-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADPART]]
 
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
+
{{#set: common-name=a 5-l-glutamyl-[peptide]}}
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
 
{{#set: molecular-weight=714.24}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 5-L-GLUTAMYL-PEPTIDE

  • common-name:
    • a 5-l-glutamyl-[peptide]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5-l-glutamyl-[peptide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.