Difference between revisions of "5-METHYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...")
(Created page with "Category:metabolite == Metabolite Tetradec-2-enoyl-ACPs == * common-name: ** a trans tetradec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9538...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S ==
+
== Metabolite Tetradec-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
+
** a trans tetradec-2-enoyl-[acp]
* smiles:
 
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 
* inchi-key:
 
** bujztfindcqrgp-ztvljyeesa-l
 
* molecular-weight:
 
** 457.362
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12177]]
+
* [[RXN-9538]]
 +
* [[RXN-9662]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9537]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
+
{{#set: common-name=a trans tetradec-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
 
{{#set: molecular-weight=457.362}}
 

Revision as of 11:15, 15 January 2021

Metabolite Tetradec-2-enoyl-ACPs

  • common-name:
    • a trans tetradec-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans tetradec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.