Difference between revisions of "5-METHYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite 5-METHYL-THF == * common-name: ** 5-methyltetrahydrofolate mono-l-glutamate * smiles: ** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GAMA-TOCOPHEROL ==
+
== Metabolite 5-METHYL-THF ==
 
* common-name:
 
* common-name:
** γ-tocopherol
+
** 5-methyltetrahydrofolate mono-l-glutamate
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
+
** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3))
 
* inchi-key:
 
* inchi-key:
** quedxnhftdjviy-dqczwyhmsa-n
+
** znovtxrbgfnyrx-stqmwfeesa-l
 
* molecular-weight:
 
* molecular-weight:
** 416.686
+
** 457.445
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
 +
* [[MTHFO]]
 +
* [[MTHFO_LPAREN_nadp_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-tocopherol}}
+
{{#set: common-name=5-methyltetrahydrofolate mono-l-glutamate}}
{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
+
{{#set: inchi-key=inchikey=znovtxrbgfnyrx-stqmwfeesa-l}}
{{#set: molecular-weight=416.686}}
+
{{#set: molecular-weight=457.445}}

Latest revision as of 11:14, 18 March 2021

Metabolite 5-METHYL-THF

  • common-name:
    • 5-methyltetrahydrofolate mono-l-glutamate
  • smiles:
    • cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3))
  • inchi-key:
    • znovtxrbgfnyrx-stqmwfeesa-l
  • molecular-weight:
    • 457.445

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality