Difference between revisions of "5-METHYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21836 == * transcription-direction: ** negative * right-end-position: ** 181287 * left-end-position: ** 175432 * centisome-position: ** 94.58832...")
(Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-key: ** rdikfprvljlmer-bqbzgakwsa...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21836 ==
+
== Metabolite CPD-13398 ==
* transcription-direction:
+
* common-name:
** negative
+
** l-alanyl-l-leucine
* right-end-position:
+
* smiles:
** 181287
+
** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
* left-end-position:
+
* inchi-key:
** 175432
+
** rdikfprvljlmer-bqbzgakwsa-n
* centisome-position:
+
* molecular-weight:
** 94.58832   
+
** 202.253
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-6979]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=l-alanyl-l-leucine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=rdikfprvljlmer-bqbzgakwsa-n}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=202.253}}
{{#set: right-end-position=181287}}
 
{{#set: left-end-position=175432}}
 
{{#set: centisome-position=94.58832    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-13398

  • common-name:
    • l-alanyl-l-leucine
  • smiles:
    • cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
  • inchi-key:
    • rdikfprvljlmer-bqbzgakwsa-n
  • molecular-weight:
    • 202.253

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality