Difference between revisions of "5-METHYLCYTOSINE-34-TRNA-PRECURSORS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7222 == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
(Created page with "Category:metabolite == Metabolite 3-oxo-stearoyl-ACPs == * common-name: ** a 3-oxo-stearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9633 == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7222 ==
+
== Metabolite 3-oxo-stearoyl-ACPs ==
 
* common-name:
 
* common-name:
** (2e)-dodec-2-enoyl-coa
+
** a 3-oxo-stearoyl-[acp]
* smiles:
 
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
 
* inchi-key:
 
** irfyvbulxzmede-xcfippspsa-j
 
* molecular-weight:
 
** 943.792
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH5]]
+
* [[RXN-9633]]
* [[ECOAH5h]]
 
* [[ECOAH5m]]
 
* [[RXN-14262]]
 
* [[RXN-7931]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA120OR]]
+
* [[RXN-9632]]
* [[ECOAH5]]
+
* [[RXN3O-1803]]
* [[ECOAH5h]]
 
* [[ECOAH5m]]
 
* [[RXN-14262]]
 
* [[RXN-7931]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
+
{{#set: common-name=a 3-oxo-stearoyl-[acp]}}
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
 
{{#set: molecular-weight=943.792}}
 

Revision as of 15:29, 5 January 2021

Metabolite 3-oxo-stearoyl-ACPs

  • common-name:
    • a 3-oxo-stearoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-stearoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.