Difference between revisions of "5-METHYLCYTOSINE-34-TRNA-PRECURSORS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-stearoyl-ACPs == * common-name: ** a 3-oxo-stearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9633 == Reactio...") |
(Created page with "Category:metabolite == Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE == * common-name: ** 5-amino-6-(d-ribitylamino)uracil * smiles: ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-amino-6-(d-ribitylamino)uracil |
| + | * smiles: | ||
| + | ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co | ||
| + | * inchi-key: | ||
| + | ** xkqzixvjvupore-rpdrrwsusa-n | ||
| + | * molecular-weight: | ||
| + | ** 276.249 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[LUMAZINESYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RIBOFLAVIN-SYN-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-6-(d-ribitylamino)uracil}} |
| + | {{#set: inchi-key=inchikey=xkqzixvjvupore-rpdrrwsusa-n}} | ||
| + | {{#set: molecular-weight=276.249}} | ||
Revision as of 13:12, 14 January 2021
Contents
Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE
- common-name:
- 5-amino-6-(d-ribitylamino)uracil
- smiles:
- c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
- inchi-key:
- xkqzixvjvupore-rpdrrwsusa-n
- molecular-weight:
- 276.249
