Difference between revisions of "5-METHYLTHIOADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3483 == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** akoaevosdhivfx-uhfffa...") |
(Created page with "Category:metabolite == Metabolite MAP-Kinase-L-Tyr == * common-name: ** a [mitogen-activated protein kinase]-l-tyrosine == Reaction(s) known to consume the compound == * [...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MAP-Kinase-L-Tyr == |
* common-name: | * common-name: | ||
− | ** | + | ** a [mitogen-activated protein kinase]-l-tyrosine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16317]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16317]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [mitogen-activated protein kinase]-l-tyrosine}} |
− | |||
− |
Revision as of 15:27, 5 January 2021
Contents
Metabolite MAP-Kinase-L-Tyr
- common-name:
- a [mitogen-activated protein kinase]-l-tyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [mitogen-activated protein kinase]-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.