Difference between revisions of "5-METHYLTHIOADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-17396 == * common-name: ** a [glycerolipid]-ricinoleate == Reaction(s) known to consume the compound == * RXN-16149 * RXN-16151...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17396 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-ricinoleate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16149]] |
| − | * [[ | + | * [[RXN-16151]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16151]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-ricinoleate}} |
| − | |||
| − | |||
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-17396
- common-name:
- a [glycerolipid]-ricinoleate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-ricinoleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
