Difference between revisions of "5-Methylcytosine-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glycogens == * common-name: ** a glycogen == Reaction(s) known to consume the compound == * GLYCOPHOSPHORYL-RXN * GLYMALTOPHOSPHORY...") |
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12481 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methylurate |
| + | * smiles: | ||
| + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) | ||
| + | * inchi-key: | ||
| + | ** yhnnpkufpwltop-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 182.138 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11521]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methylurate}} |
| + | {{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=182.138}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-12481
- common-name:
- 7-methylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
- inchi-key:
- yhnnpkufpwltop-uhfffaoysa-n
- molecular-weight:
- 182.138
