Difference between revisions of "5-Methylcytosine-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * m...") |
(Created page with "Category:metabolite == Metabolite 5-Methylcytosine-DNA == * common-name: ** a 5-methylcytosine in dna == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-Methylcytosine-DNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-methylcytosine in dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-methylcytosine in dna}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-Methylcytosine-DNA
- common-name:
- a 5-methylcytosine in dna
