Difference between revisions of "5-P-BETA-D-RIBOSYL-AMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite D-RIBULOSE == * common-name: ** d-ribulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-nqxxgfsbsa-n * molecular-weigh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-RIBULOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ribulose |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c(o)c(o)c(=o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zaqjhhrnxzubte-nqxxgfsbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribulose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zaqjhhrnxzubte-nqxxgfsbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite D-RIBULOSE
- common-name:
- d-ribulose
- smiles:
- c(o)c(o)c(o)c(=o)co
- inchi-key:
- zaqjhhrnxzubte-nqxxgfsbsa-n
- molecular-weight:
- 150.131
