Difference between revisions of "5-P-BETA-D-RIBOSYL-AMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12959 RXN-12959] == * direction: ** left-to-right * common-name: ** diacylglycerol kinase (ctp)...")
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * inc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12959 RXN-12959] ==
+
== Metabolite 5-P-BETA-D-RIBOSYL-AMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** diacylglycerol kinase (ctp)
+
** 5-phospho-β-d-ribosylamine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.174 ec-2.7.1.174]
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CTP]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[CDP]][c] '''+''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c]
+
** skcbpevygoqgjn-txicztdvsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ12057]]
+
** 228.118
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GLYRIBONUCSYN-RXN]]
−
* Gene: [[SJ12148]]
+
* [[PRPPAMIDOTRANS-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PRPPAMIDOTRANS-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
+
{{#set: common-name=5-phospho-β-d-ribosylamine}}
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=228.118}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R09944 R09944]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25951 25951]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=diacylglycerol kinase (ctp)}}
 
−
{{#set: ec-number=ec-2.7.1.174}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 5-P-BETA-D-RIBOSYL-AMINE

  • common-name:
    • 5-phospho-β-d-ribosylamine
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
  • inchi-key:
    • skcbpevygoqgjn-txicztdvsa-m
  • molecular-weight:
    • 228.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-P-BETA-D-RIBOSYL-AMINE&oldid=138835"