Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13163 RXN-13163] == * direction: ** reversible * common-name: ** at2g43090.1 * ec-number: ** [h...")
 
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13163 RXN-13163] ==
+
== Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** at2g43090.1
+
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.33 ec-4.2.1.33]
+
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE]][c] '''<=>''' 1 [[3-CARBOXY-3-HYDROXY-ISOCAPROATE]][c]
+
** vdxlundmvkskho-xvfcmesisa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09771]]
+
** 312.172
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[FGAMSYN-RXN]]
−
* Gene: [[SJ22396]]
+
* [[FGFTh]]
−
** Category: [[annotation]]
+
* [[FPGFTh]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GART-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[FPGFTh]]
−
== Pathway(s) ==
+
* [[GART-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=n2-formyl-n1-(5-phospho-&beta;-d-ribosyl)glycinamide}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}
−
== External links  ==
+
{{#set: molecular-weight=312.172}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04001 R04001]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10679 10679]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=at2g43090.1}}
 
−
{{#set: ec-number=ec-4.2.1.33}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE

  • common-name:
    • n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
  • smiles:
    • c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
  • inchi-key:
    • vdxlundmvkskho-xvfcmesisa-l
  • molecular-weight:
    • 312.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE&oldid=138674"