Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXYPROPANAL == * common-name: ** 3-hydroxypropionaldehyde * smiles: ** c([ch]=o)co * inchi-key: ** akxkfzdcryjktf-uhfffaoysa-n * mole...")
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite HYDROXYPROPANAL ==
+
== Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE ==
 
* common-name:
 
* common-name:
−
** 3-hydroxypropionaldehyde
+
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
 
* smiles:
 
* smiles:
−
** c([ch]=o)co
+
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
* inchi-key:
−
** akxkfzdcryjktf-uhfffaoysa-n
+
** vdxlundmvkskho-xvfcmesisa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 74.079
+
** 312.172
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FGAMSYN-RXN]]
 +
* [[FGFTh]]
 +
* [[FPGFTh]]
 +
* [[GART-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[GLYCEROL-DEHYDRATASE-RXN]]
+
* [[FPGFTh]]
 +
* [[GART-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-hydroxypropionaldehyde}}
+
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
−
{{#set: inchi-key=inchikey=akxkfzdcryjktf-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}
−
{{#set: molecular-weight=74.079}}
+
{{#set: molecular-weight=312.172}}

Latest revision as of 11:15, 18 March 2021

Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE

  • common-name:
    • n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
  • smiles:
    • c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
  • inchi-key:
    • vdxlundmvkskho-xvfcmesisa-l
  • molecular-weight:
    • 312.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE&oldid=138674"