Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite A-GALACTOSYLCERAMIDE == * common-name: ** a β-d-galactosyl-n-acylsphingosine == Reaction(s) known to consume the compound == * RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-7139 == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7139 == |
* common-name: | * common-name: | ||
− | ** | + | ** delphinidin 3,5-di-o-β-d-glucoside |
+ | * smiles: | ||
+ | ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5))) | ||
+ | * inchi-key: | ||
+ | ** xctgxgvgjyacei-lcenjuansa-n | ||
+ | * molecular-weight: | ||
+ | ** 626.524 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8228]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}} |
+ | {{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}} | ||
+ | {{#set: molecular-weight=626.524}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-7139
- common-name:
- delphinidin 3,5-di-o-β-d-glucoside
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
- inchi-key:
- xctgxgvgjyacei-lcenjuansa-n
- molecular-weight:
- 626.524