Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7139 == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(c...")
(Created page with "Category:metabolite == Metabolite CPD-15616 == * common-name: ** keto-l-sorbose * smiles: ** c(o)c(=o)c(o)c(o)c(o)co * inchi-key: ** bjhikxhvcxfqls-otwzmjiisa-n * molecula...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7139 ==
+
== Metabolite CPD-15616 ==
 
* common-name:
 
* common-name:
** delphinidin 3,5-di-o-β-d-glucoside
+
** keto-l-sorbose
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
+
** c(o)c(=o)c(o)c(o)c(o)co
 
* inchi-key:
 
* inchi-key:
** xctgxgvgjyacei-lcenjuansa-n
+
** bjhikxhvcxfqls-otwzmjiisa-n
 
* molecular-weight:
 
* molecular-weight:
** 626.524
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8228]]
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}}
+
{{#set: common-name=keto-l-sorbose}}
{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
+
{{#set: inchi-key=inchikey=bjhikxhvcxfqls-otwzmjiisa-n}}
{{#set: molecular-weight=626.524}}
+
{{#set: molecular-weight=180.157}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-15616

  • common-name:
    • keto-l-sorbose
  • smiles:
    • c(o)c(=o)c(o)c(o)c(o)co
  • inchi-key:
    • bjhikxhvcxfqls-otwzmjiisa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality