Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite HYDROXYPROPANAL == * common-name: ** 3-hydroxypropionaldehyde * smiles: ** c([ch]=o)co * inchi-key: ** akxkfzdcryjktf-uhfffaoysa-n * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HYDROXYPROPANAL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hydroxypropionaldehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** c([ch]=o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** akxkfzdcryjktf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 74.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLYCEROL-DEHYDRATASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hydroxypropionaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=akxkfzdcryjktf-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.079}} |
Revision as of 18:57, 14 January 2021
Contents
Metabolite HYDROXYPROPANAL
- common-name:
- 3-hydroxypropionaldehyde
- smiles:
- c([ch]=o)co
- inchi-key:
- akxkfzdcryjktf-uhfffaoysa-n
- molecular-weight:
- 74.079
