Difference between revisions of "5-PHOSPHO-RIBOSYL-GLYCINEAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HPPD HPPD] == * direction: ** left-to-right * common-name: ** p-hydroxyphenylpyruvate dioxygenase =...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** n1-(5-phospho-β-d-ribosyl)glycinamide |
| − | + | * smiles: | |
| − | * | + | ** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) |
| − | == | + | * inchi-key: |
| − | * | + | ** obqmlsfouzuiob-shuuezrqsa-m |
| − | * | + | * molecular-weight: |
| − | + | ** 285.17 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[FPGFTh]] | |
| − | * | + | * [[GART-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[FGFTh]] |
| − | + | * [[FPGFTh]] | |
| − | {{#set: | + | * [[GART-RXN]] |
| − | + | * [[GLYRIBONUCSYN-RXN]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}} | |
| − | + | {{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}} | |
| − | + | {{#set: molecular-weight=285.17}} | |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE
- common-name:
- n1-(5-phospho-β-d-ribosyl)glycinamide
- smiles:
- c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- obqmlsfouzuiob-shuuezrqsa-m
- molecular-weight:
- 285.17
