Difference between revisions of "5-PHOSPHO-RIBOSYL-GLYCINEAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADH-DEHYDROGENASE-RXN NADH-DEHYDROGENASE-RXN] == * direction: ** reversible * common-name: ** nadh...")
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADH-DEHYDROGENASE-RXN NADH-DEHYDROGENASE-RXN] ==
+
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** nadh dehydrogenase
+
** n1-(5-phospho-β-d-ribosyl)glycinamide
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.6.99.3 ec-1.6.99.3]
+
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
== Reaction formula ==
+
* inchi-key:
* 1 [[Acceptor]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[Donor-H2]][c] '''+''' 1 [[NAD]][c]
+
** obqmlsfouzuiob-shuuezrqsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 285.17
* Gene: [[SJ19948]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[FPGFTh]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GART-RXN]]
* Gene: [[SJ15310]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[FGFTh]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[FPGFTh]]
* Gene: [[SJ09960]]
+
* [[GART-RXN]]
** Category: [[annotation]]
+
* [[GLYRIBONUCSYN-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ21333]]
+
{{#set: common-name=n1-(5-phospho-&beta;-d-ribosyl)glycinamide}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=285.17}}
* Gene: [[SJ18811]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ21897]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ10422]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ05715]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ18864]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ02821]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ14995]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ21137]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ22333]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ19806]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ16410]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ19412]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ02471]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ21017]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ05616]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ04738]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11359 11359]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00281 R00281]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P21301 P21301]
 
** [http://www.uniprot.org/uniprot/O05267 O05267]
 
** [http://www.uniprot.org/uniprot/P04394 P04394]
 
** [http://www.uniprot.org/uniprot/P80861 P80861]
 
** [http://www.uniprot.org/uniprot/P44856 P44856]
 
** [http://www.uniprot.org/uniprot/P00393 P00393]
 
** [http://www.uniprot.org/uniprot/P52504 P52504]
 
** [http://www.uniprot.org/uniprot/O75380 O75380]
 
** [http://www.uniprot.org/uniprot/Q7M2F7 Q7M2F7]
 
** [http://www.uniprot.org/uniprot/Q7M2F8 Q7M2F8]
 
** [http://www.uniprot.org/uniprot/Q7M2G8 Q7M2G8]
 
** [http://www.uniprot.org/uniprot/Q7M2F9 Q7M2F9]
 
** [http://www.uniprot.org/uniprot/Q7M2G0 Q7M2G0]
 
** [http://www.uniprot.org/uniprot/Q7M2G1 Q7M2G1]
 
** [http://www.uniprot.org/uniprot/Q7M2G2 Q7M2G2]
 
** [http://www.uniprot.org/uniprot/Q7M2G3 Q7M2G3]
 
** [http://www.uniprot.org/uniprot/Q7M2G4 Q7M2G4]
 
** [http://www.uniprot.org/uniprot/Q7M2G7 Q7M2G7]
 
** [http://www.uniprot.org/uniprot/P23934 P23934]
 
** [http://www.uniprot.org/uniprot/P42116 P42116]
 
** [http://www.uniprot.org/uniprot/P73739 P73739]
 
** [http://www.uniprot.org/uniprot/P74614 P74614]
 
** [http://www.uniprot.org/uniprot/Q35322 Q35322]
 
</div>
 
{{#set: direction=reversible}}
 
{{#set: common-name=nadh dehydrogenase}}
 
{{#set: ec-number=ec-1.6.99.3}}
 
{{#set: nb gene associated=20}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE

  • common-name:
    • n1-(5-phospho-β-d-ribosyl)glycinamide
  • smiles:
    • c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
  • inchi-key:
    • obqmlsfouzuiob-shuuezrqsa-m
  • molecular-weight:
    • 285.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality