Difference between revisions of "5-PHOSPHO-RIBOSYL-GLYCINEAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite VibB == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** n1-(5-phospho-β-d-ribosyl)glycinamide |
+ | * smiles: | ||
+ | ** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) | ||
+ | * inchi-key: | ||
+ | ** obqmlsfouzuiob-shuuezrqsa-m | ||
+ | * molecular-weight: | ||
+ | ** 285.17 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[FPGFTh]] |
+ | * [[GART-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[FGFTh]] |
+ | * [[FPGFTh]] | ||
+ | * [[GART-RXN]] | ||
+ | * [[GLYRIBONUCSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}} |
+ | {{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}} | ||
+ | {{#set: molecular-weight=285.17}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE
- common-name:
- n1-(5-phospho-β-d-ribosyl)glycinamide
- smiles:
- c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- obqmlsfouzuiob-shuuezrqsa-m
- molecular-weight:
- 285.17