Difference between revisions of "5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-valine == * common-name: ** an n-terminal l-valyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == * common-name: ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine * smiles: ** c(nc=o...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine |
+ | * smiles: | ||
+ | ** c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) | ||
+ | * inchi-key: | ||
+ | ** pmcogcvkoaozqm-xvfcmesisa-m | ||
+ | * molecular-weight: | ||
+ | ** 312.196 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[AIRS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[FGAMSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine}} |
+ | {{#set: inchi-key=inchikey=pmcogcvkoaozqm-xvfcmesisa-m}} | ||
+ | {{#set: molecular-weight=312.196}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE
- common-name:
- 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
- smiles:
- c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- pmcogcvkoaozqm-xvfcmesisa-m
- molecular-weight:
- 312.196