Difference between revisions of "5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12196 == * transcription-direction: ** positive * right-end-position: ** 212875 * left-end-position: ** 207441 * centisome-position: ** 27.120087...")
 
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == * common-name: ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine * smiles: ** c(nc=o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12196 ==
+
== Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE ==
* transcription-direction:
+
* common-name:
** positive
+
** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
* right-end-position:
+
* smiles:
** 212875
+
** c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
* left-end-position:
+
* inchi-key:
** 207441
+
** pmcogcvkoaozqm-xvfcmesisa-m
* centisome-position:
+
* molecular-weight:
** 27.120087   
+
** 312.196
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[AIRS-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.7.10.1-RXN]]
+
* [[FGAMSYN-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine}}
* [[PROTEIN-KINASE-RXN]]
+
{{#set: inchi-key=inchikey=pmcogcvkoaozqm-xvfcmesisa-m}}
** Category: [[annotation]]
+
{{#set: molecular-weight=312.196}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=212875}}
 
{{#set: left-end-position=207441}}
 
{{#set: centisome-position=27.120087    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE

  • common-name:
    • 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
  • smiles:
    • c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
  • inchi-key:
    • pmcogcvkoaozqm-xvfcmesisa-m
  • molecular-weight:
    • 312.196

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality