Difference between revisions of "5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19759 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o...")
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == * common-name: ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine * smiles: ** c(nc=o...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19759 ==
+
== Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE ==
 +
* common-name:
 +
** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
* common-name:
+
* inchi-key:
** 71-dihydroxychlorophyllide a
+
** pmcogcvkoaozqm-xvfcmesisa-m
 
* molecular-weight:
 
* molecular-weight:
** 644.965
+
** 312.196
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AIRS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7677]]
+
* [[FGAMSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=71-dihydroxychlorophyllide a}}
+
{{#set: common-name=2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine}}
{{#set: molecular-weight=644.965}}
+
{{#set: inchi-key=inchikey=pmcogcvkoaozqm-xvfcmesisa-m}}
 +
{{#set: molecular-weight=312.196}}

Latest revision as of 11:12, 18 March 2021

Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE

  • common-name:
    • 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
  • smiles:
    • c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
  • inchi-key:
    • pmcogcvkoaozqm-xvfcmesisa-m
  • molecular-weight:
    • 312.196

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality