Difference between revisions of "5-Phospho-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-formyl-L-methionyl-tRNAfmet == * common-name: ** an n-formyl-l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MENADIOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** menadiol |
| + | * smiles: | ||
| + | ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) | ||
| + | * inchi-key: | ||
| + | ** zjtlzydqjhkrmq-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 174.199 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menadiol}} |
| + | {{#set: inchi-key=inchikey=zjtlzydqjhkrmq-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=174.199}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite MENADIOL
- common-name:
- menadiol
- smiles:
- cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))
- inchi-key:
- zjtlzydqjhkrmq-uhfffaoysa-n
- molecular-weight:
- 174.199
