Difference between revisions of "5-Phospho-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o * inchi-key: ** gactwzzmvmukng...")
(Created page with "Category:metabolite == Metabolite L-Cysteine-Desulfurases == * common-name: ** an [l-cysteine desulfurase] == Reaction(s) known to consume the compound == * RXN-15881...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MANNITOL-1P ==
+
== Metabolite L-Cysteine-Desulfurases ==
 
* common-name:
 
* common-name:
** d-mannitol 1-phosphate
+
** an [l-cysteine desulfurase]
* smiles:
 
** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
 
* inchi-key:
 
** gactwzzmvmukng-kvtdhhqdsa-l
 
* molecular-weight:
 
** 260.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MANNITOL-1-PHOSPHATASE-RXN]]
+
* [[RXN-15881]]
* [[MANNPDEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPDEHYDROG-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-mannitol 1-phosphate}}
+
{{#set: common-name=an [l-cysteine desulfurase]}}
{{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}}
 
{{#set: molecular-weight=260.137}}
 

Revision as of 15:25, 5 January 2021

Metabolite L-Cysteine-Desulfurases

  • common-name:
    • an [l-cysteine desulfurase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [l-cysteine desulfurase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.