Difference between revisions of "5-Phospho-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-2Fe-2S-Ferredoxins == * common-name: ** a reduced [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == * 2.8.1.6...")
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-2Fe-2S-Ferredoxins ==
+
== Metabolite CPD-16953 ==
 
* common-name:
 
* common-name:
** a reduced [2fe-2s] ferredoxin
+
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
 +
* smiles:
 +
** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
 +
* inchi-key:
 +
** ghrbcdhnysufrn-iuyqgcfvsa-n
 +
* molecular-weight:
 +
** 223.234
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
+
* [[RXN-15733]]
* [[RXN-11586]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-949]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced [2fe-2s] ferredoxin}}
+
{{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
 +
{{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}}
 +
{{#set: molecular-weight=223.234}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-16953

  • common-name:
    • 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
  • smiles:
    • cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
  • inchi-key:
    • ghrbcdhnysufrn-iuyqgcfvsa-n
  • molecular-weight:
    • 223.234

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.