Difference between revisions of "5-Phospho-DNA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18488 == * transcription-direction: ** positive * right-end-position: ** 171130 * left-end-position: ** 153149 * centisome-position: ** 62.794804...") |
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * smiles: ** c(cc(=o)c(=o)[o-])cc(=o)[o-] * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * mole...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 2K-ADIPATE == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-oxoadipate |
| − | * | + | * smiles: |
| − | ** | + | ** c(cc(=o)c(=o)[o-])cc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** fgsbnbbhozhubo-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 158.11 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2-KETO-ADIPATE-DEHYDROG-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=2-oxoadipate}} | |
| − | + | {{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}} | |
| − | + | {{#set: molecular-weight=158.11}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite 2K-ADIPATE
- common-name:
- 2-oxoadipate
- smiles:
- c(cc(=o)c(=o)[o-])cc(=o)[o-]
- inchi-key:
- fgsbnbbhozhubo-uhfffaoysa-l
- molecular-weight:
- 158.11
