Difference between revisions of "5-Phospho-RNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
(Created page with "Category:metabolite == Metabolite Hyaluronan-NAc-glucosaminide == * common-name: ** n-acetyl-α-d-glucosaminyl-[hyaluronan] == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Hyaluronan-NAc-glucosaminide == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-α-d-glucosaminyl-[hyaluronan] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.4.1.212-RXN]] | ||
| + | * [[RXN-11627]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11627]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-glucosaminyl-[hyaluronan]}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite Hyaluronan-NAc-glucosaminide
- common-name:
- n-acetyl-α-d-glucosaminyl-[hyaluronan]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "n-acetyl-α-d-glucosaminyl-[hyaluronan" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
