Difference between revisions of "5-Phospho-RNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite 5-Phospho-RNA == * common-name: ** a 5'-phospho-ribonucleoside-[rna] == Reaction(s) known to consume the compound == * RNA-LIGASE-ATP-R...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUC-COA ==
+
== Metabolite 5-Phospho-RNA ==
 
* common-name:
 
* common-name:
** succinyl-coa
+
** a 5'-phospho-ribonucleoside-[rna]
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vnoyujkhfwywir-itiydsspsa-i
 
* molecular-weight:
 
** 862.568
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
+
* [[RNA-LIGASE-ATP-RXN]]
* [[HOMSUCTRAN-RXN]]
+
* [[RXN-17926]]
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2OXOGLUTARATEDEH-RXN]]
 
* [[AKGDHe2r]]
 
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinyl-coa}}
+
{{#set: common-name=a 5'-phospho-ribonucleoside-[rna]}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
 
{{#set: molecular-weight=862.568}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 5-Phospho-RNA

  • common-name:
    • a 5'-phospho-ribonucleoside-[rna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-phospho-ribonucleoside-[rna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.