Difference between revisions of "5-Phospho-RNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
(Created page with "Category:metabolite == Metabolite 5-Phospho-RNA == * common-name: ** a 5'-phospho-ribonucleoside-[rna] == Reaction(s) known to consume the compound == * RNA-LIGASE-ATP-R...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-Phospho-RNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5'-phospho-ribonucleoside-[rna] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RNA-LIGASE-ATP-RXN]] | ||
| + | * [[RXN-17926]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5'-phospho-ribonucleoside-[rna]}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-Phospho-RNA
- common-name:
- a 5'-phospho-ribonucleoside-[rna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-phospho-ribonucleoside-[rna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
