Difference between revisions of "5-Phospho-RNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-Methylcytosine-DNA == * common-name: ** a 5-methylcytosine in dna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-Methylcytosine-DNA ==
+
== Metabolite 2-OCTAPRENYLPHENOL ==
 
* common-name:
 
* common-name:
** a 5-methylcytosine in dna
+
** 2-octaprenylphenol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** vunqjppptjiren-cmaxttdksa-n
 +
* molecular-weight:
 +
** 639.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-methylcytosine in dna}}
+
{{#set: common-name=2-octaprenylphenol}}
 +
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
 +
{{#set: molecular-weight=639.058}}

Revision as of 13:10, 14 January 2021

Metabolite 2-OCTAPRENYLPHENOL

  • common-name:
    • 2-octaprenylphenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • vunqjppptjiren-cmaxttdksa-n
  • molecular-weight:
    • 639.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality