Difference between revisions of "5-methylcytosine2870-in-25S-rRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...") |
(Created page with "Category:metabolite == Metabolite 5-methylcytosine2870-in-25S-rRNA == * common-name: ** a 5-methylcytosine2870 in 25s rrna == Reaction(s) known to consume the compound ==...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-methylcytosine2870-in-25S-rRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-methylcytosine2870 in 25s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15843]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-methylcytosine2870 in 25s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 5-methylcytosine2870-in-25S-rRNA
- common-name:
- a 5-methylcytosine2870 in 25s rrna
