Difference between revisions of "5-ppp-Pur-mRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-403 == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=c1o)n)c([o-])=o) * inchi-key: ** oyzonaxdawhdmn-uhf...") |
(Created page with "Category:metabolite == Metabolite 5-ppp-Pur-mRNA == * common-name: ** a 5'-triphospho-purine-[mrna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-PH...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-ppp-Pur-mRNA == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5'-triphospho-purine-[mrna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5'-triphospho-purine-[mrna]}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-ppp-Pur-mRNA
- common-name:
- a 5'-triphospho-purine-[mrna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-triphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.