Difference between revisions of "5-ppp-Pur-mRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8579 == * common-name: ** a [histone] n6-methyl-l-lysine == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
(Created page with "Category:metabolite == Metabolite CPD-403 == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=c1o)n)c([o-])=o) * inchi-key: ** oyzonaxdawhdmn-uhf...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8579 ==
+
== Metabolite CPD-403 ==
 
* common-name:
 
* common-name:
** a [histone] n6-methyl-l-lysine
+
** 3-hydroxy-4-methylanthranilate
 +
* smiles:
 +
** cc1(=cc=c(c(=c1o)n)c([o-])=o)
 +
* inchi-key:
 +
** oyzonaxdawhdmn-uhfffaoysa-m
 +
* molecular-weight:
 +
** 166.156
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17077]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-17077]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [histone] n6-methyl-l-lysine}}
+
{{#set: common-name=3-hydroxy-4-methylanthranilate}}
 +
{{#set: inchi-key=inchikey=oyzonaxdawhdmn-uhfffaoysa-m}}
 +
{{#set: molecular-weight=166.156}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-403

  • common-name:
    • 3-hydroxy-4-methylanthranilate
  • smiles:
    • cc1(=cc=c(c(=c1o)n)c([o-])=o)
  • inchi-key:
    • oyzonaxdawhdmn-uhfffaoysa-m
  • molecular-weight:
    • 166.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality