Difference between revisions of "5-ppp-Pur-mRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-403 == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=c1o)n)c([o-])=o) * inchi-key: ** oyzonaxdawhdmn-uhf...") |
(Created page with "Category:metabolite == Metabolite CPD-11512 == * common-name: ** a (2r,3s,4s)-leucoanthocyanidin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11512 == |
* common-name: | * common-name: | ||
− | ** | + | ** a (2r,3s,4s)-leucoanthocyanidin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17678]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a (2r,3s,4s)-leucoanthocyanidin}} |
− | |||
− |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-11512
- common-name:
- a (2r,3s,4s)-leucoanthocyanidin