Difference between revisions of "5-ppp-Pur-mRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-403 == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=c1o)n)c([o-])=o) * inchi-key: ** oyzonaxdawhdmn-uhf...")
(Created page with "Category:metabolite == Metabolite CPD-11512 == * common-name: ** a (2r,3s,4s)-leucoanthocyanidin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-403 ==
+
== Metabolite CPD-11512 ==
 
* common-name:
 
* common-name:
** 3-hydroxy-4-methylanthranilate
+
** a (2r,3s,4s)-leucoanthocyanidin
* smiles:
 
** cc1(=cc=c(c(=c1o)n)c([o-])=o)
 
* inchi-key:
 
** oyzonaxdawhdmn-uhfffaoysa-m
 
* molecular-weight:
 
** 166.156
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17077]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17077]]
+
* [[RXN-17678]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-4-methylanthranilate}}
+
{{#set: common-name=a (2r,3s,4s)-leucoanthocyanidin}}
{{#set: inchi-key=inchikey=oyzonaxdawhdmn-uhfffaoysa-m}}
 
{{#set: molecular-weight=166.156}}
 

Revision as of 13:11, 14 January 2021

Metabolite CPD-11512

  • common-name:
    • a (2r,3s,4s)-leucoanthocyanidin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality