Difference between revisions of "50S-Ribo-protein-L16-Hydroxylarginine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11963 RXN-11963] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/2.5...")
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi-key: ** wfnzgu...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11963 RXN-11963] ==
+
== Metabolite CPD-11555 ==
−
* direction:
+
* common-name:
−
** reversible
+
** octoketide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.87 ec-2.5.1.87]
+
** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
−
== Reaction formula ==
+
* inchi-key:
−
* n [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[FARNESYL-PP]][c] '''<=>''' 1 [[Di-trans-poly-cis-polyprenyl-PP]][c] '''+''' n [[PPI]][c]
+
** wfnzgunbscuxfx-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18388]]
+
** 317.274
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-10734]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=octoketide}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}}
−
{{#set: direction=reversible}}
+
{{#set: molecular-weight=317.274}}
−
{{#set: ec-number=ec-2.5.1.87}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-11555

  • common-name:
    • octoketide
  • smiles:
    • cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
  • inchi-key:
    • wfnzgunbscuxfx-uhfffaoysa-m
  • molecular-weight:
    • 317.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=50S-Ribo-protein-L16-Hydroxylarginine&oldid=48350"